C22H32Cl2N4OS — CID 171329781
5-[[(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-2-pyrrolidin-1-yl-1,3-thiazole;dihydrochloride (PubChem CID 171329781) has the molecular formula C22H32Cl2N4OS and a molecular weight of 471.50 g/mol. Its IUPAC name is 5-[[(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-2-pyrrolidin-1-yl-1,3-thiazole;dihydrochloride.
| Compound Name | 5-[[(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-2-pyrrolidin-1-yl-1,3-thiazole;dihydrochloride |
|---|---|
| PubChem CID | 171329781 |
| Molecular Formula | C22H32Cl2N4OS |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 5-[[(3S,3aS,6aR)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-2-pyrrolidin-1-yl-1,3-thiazole;dihydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(Cc4cnc(N5CCCC5)s4)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C22H30N4OS.2ClH/c1-24-12-17-13-25(14-19-11-23-22(28-19)26-9-3-4-10-26)15-20(17)21(24)16-5-7-18(27-2)8-6-16;;/h5-8,11,17,20-21H,3-4,9-10,12-15H2,1-2H3;2*1H/t17-,20+,21+;;/m0../s1 |
| InChIKey | FKPBHNQAWNNWIR-QHXMKMDKSA-N |
| XLogP | 4.33 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |