C22H26N4O3 — CID 170502917
2-[2-[(3aR,4S,6aS)-4-phenyl-5-propanoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethyl]-6-methylpyridazin-3-one (PubChem CID 170502917) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[2-[(3aR,4S,6aS)-4-phenyl-5-propanoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethyl]-6-methylpyridazin-3-one.
| Compound Name | 2-[2-[(3aR,4S,6aS)-4-phenyl-5-propanoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 170502917 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[2-[(3aR,4S,6aS)-4-phenyl-5-propanoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethyl]-6-methylpyridazin-3-one |
| SMILES | CCC(=O)N1C[C@@H]2CN(C(=O)Cn3nc(C)ccc3=O)C[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H26N4O3/c1-3-19(27)25-12-17-11-24(13-18(17)22(25)16-7-5-4-6-8-16)21(29)14-26-20(28)10-9-15(2)23-26/h4-10,17-18,22H,3,11-14H2,1-2H3/t17-,18-,22+/m0/s1 |
| InChIKey | RCBHGRHGGRRNRS-NPPFBWRTSA-N |
| XLogP | 1.62 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |