C20H24N4O5 — CID 171329972
4-[2-[(3aS,4R,6aR)-5-acetyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethyl]-1,2-dihydropyrazol-3-one;formic acid (PubChem CID 171329972) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[2-[(3aS,4R,6aR)-5-acetyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethyl]-1,2-dihydropyrazol-3-one;formic acid.
| Compound Name | 4-[2-[(3aS,4R,6aR)-5-acetyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethyl]-1,2-dihydropyrazol-3-one;formic acid |
|---|---|
| PubChem CID | 171329972 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-[2-[(3aS,4R,6aR)-5-acetyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-oxoethyl]-1,2-dihydropyrazol-3-one;formic acid |
| SMILES | CC(=O)N1C[C@H]2CN(C(=O)Cc3c[nH][nH]c3=O)C[C@H]2[C@@H]1c1ccccc1.O=CO |
| InChI | InChI=1S/C19H22N4O3.CH2O2/c1-12(24)23-10-15-9-22(17(25)7-14-8-20-21-19(14)26)11-16(15)18(23)13-5-3-2-4-6-13;2-1-3/h2-6,8,15-16,18H,7,9-11H2,1H3,(H2,20,21,26);1H,(H,2,3)/t15-,16-,18+;/m1./s1 |
| InChIKey | WMZJKIRJUKECOU-DYYUINESSA-N |
| XLogP | 0.62 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|