C23H27N3O2 — CID 170511257
1-[(3aR,4S,6aS)-2-(1-cyclopropylpyrrole-2-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one (PubChem CID 170511257) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-2-(1-cyclopropylpyrrole-2-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one.
| Compound Name | 1-[(3aR,4S,6aS)-2-(1-cyclopropylpyrrole-2-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 170511257 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[(3aR,4S,6aS)-2-(1-cyclopropylpyrrole-2-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one |
| SMILES | CCC(=O)N1C[C@@H]2CN(C(=O)c3cccn3C3CC3)C[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H27N3O2/c1-2-21(27)26-14-17-13-24(15-19(17)22(26)16-7-4-3-5-8-16)23(28)20-9-6-12-25(20)18-10-11-18/h3-9,12,17-19,22H,2,10-11,13-15H2,1H3/t17-,19-,22+/m0/s1 |
| InChIKey | YKHKWQVVKYJIAJ-LQBOVUBWSA-N |
| XLogP | 3.50 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |