C23H34ClN3O2 — CID 171707716
1-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-(azepan-1-yl)butane-1,4-dione;hydrochloride (PubChem CID 171707716) has the molecular formula C23H34ClN3O2 and a molecular weight of 420.00 g/mol. Its IUPAC name is 1-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-(azepan-1-yl)butane-1,4-dione;hydrochloride.
| Compound Name | 1-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-(azepan-1-yl)butane-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 171707716 |
| Molecular Formula | C23H34ClN3O2 |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 1-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-(azepan-1-yl)butane-1,4-dione;hydrochloride |
| SMILES | CN1C[C@H]2CN(C(=O)CCC(=O)N3CCCCCC3)C[C@H]2[C@@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C23H33N3O2.ClH/c1-24-15-19-16-26(17-20(19)23(24)18-9-5-4-6-10-18)22(28)12-11-21(27)25-13-7-2-3-8-14-25;/h4-6,9-10,19-20,23H,2-3,7-8,11-17H2,1H3;1H/t19-,20+,23-;/m0./s1 |
| InChIKey | SGJZIKVTNRXANP-JOEGFDNXSA-N |
| XLogP | 3.35 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |