C23H34ClN3O3 — CID 171709528
1-[4-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]piperidin-1-yl]-2-ethoxyethanone;hydrochloride (PubChem CID 171709528) has the molecular formula C23H34ClN3O3 and a molecular weight of 436.00 g/mol. Its IUPAC name is 1-[4-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]piperidin-1-yl]-2-ethoxyethanone;hydrochloride.
| Compound Name | 1-[4-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]piperidin-1-yl]-2-ethoxyethanone;hydrochloride |
|---|---|
| PubChem CID | 171709528 |
| Molecular Formula | C23H34ClN3O3 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-[4-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]piperidin-1-yl]-2-ethoxyethanone;hydrochloride |
| SMILES | CCOCC(=O)N1CCC(C(=O)N2C[C@@H]3CN(C)[C@@H](c4ccccc4)[C@@H]3C2)CC1.Cl |
| InChI | InChI=1S/C23H33N3O3.ClH/c1-3-29-16-21(27)25-11-9-18(10-12-25)23(28)26-14-19-13-24(2)22(20(19)15-26)17-7-5-4-6-8-17;/h4-8,18-20,22H,3,9-16H2,1-2H3;1H/t19-,20+,22-;/m0./s1 |
| InChIKey | LJSRFZSTFCEGLV-XVSUUXGCSA-N |
| XLogP | 2.44 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |