C20H25ClN4O — CID 171707120
[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone;hydrochloride (PubChem CID 171707120) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is [(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone;hydrochloride.
| Compound Name | [(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171707120 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone;hydrochloride |
| SMILES | CN1C[C@H]2CN(C(=O)c3cc(C4CC4)[nH]n3)C[C@H]2[C@@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C20H24N4O.ClH/c1-23-10-15-11-24(12-16(15)19(23)14-5-3-2-4-6-14)20(25)18-9-17(21-22-18)13-7-8-13;/h2-6,9,13,15-16,19H,7-8,10-12H2,1H3,(H,21,22);1H/t15-,16+,19-;/m0./s1 |
| InChIKey | FYHCRDKDXWUXDF-YONMQPCQSA-N |
| XLogP | 3.08 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |