C23H26Cl2N4O — CID 171686809
[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-imidazol-1-ylphenyl)methanone;dihydrochloride (PubChem CID 171686809) has the molecular formula C23H26Cl2N4O and a molecular weight of 445.39 g/mol. Its IUPAC name is [(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-imidazol-1-ylphenyl)methanone;dihydrochloride.
| Compound Name | [(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-imidazol-1-ylphenyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 171686809 |
| Molecular Formula | C23H26Cl2N4O |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-imidazol-1-ylphenyl)methanone;dihydrochloride |
| SMILES | CN1C[C@H]2CN(C(=O)c3ccc(-n4ccnc4)cc3)C[C@H]2[C@@H]1c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C23H24N4O.2ClH/c1-25-13-19-14-27(15-21(19)22(25)17-5-3-2-4-6-17)23(28)18-7-9-20(10-8-18)26-12-11-24-16-26;;/h2-12,16,19,21-22H,13-15H2,1H3;2*1H/t19-,21+,22-;;/m0../s1 |
| InChIKey | VUXCBQSCBKGGOS-FRJQNZBKSA-N |
| XLogP | 4.09 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |