C23H27ClN6O — CID 171707759
1-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(5-methyltetrazol-1-yl)phenyl]ethanone;hydrochloride (PubChem CID 171707759) has the molecular formula C23H27ClN6O and a molecular weight of 438.96 g/mol. Its IUPAC name is 1-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(5-methyltetrazol-1-yl)phenyl]ethanone;hydrochloride.
| Compound Name | 1-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(5-methyltetrazol-1-yl)phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 171707759 |
| Molecular Formula | C23H27ClN6O |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(5-methyltetrazol-1-yl)phenyl]ethanone;hydrochloride |
| SMILES | Cc1nnnn1-c1ccc(CC(=O)N2C[C@@H]3CN(C)[C@@H](c4ccccc4)[C@@H]3C2)cc1.Cl |
| InChI | InChI=1S/C23H26N6O.ClH/c1-16-24-25-26-29(16)20-10-8-17(9-11-20)12-22(30)28-14-19-13-27(2)23(21(19)15-28)18-6-4-3-5-7-18;/h3-11,19,21,23H,12-15H2,1-2H3;1H/t19-,21+,23-;/m0./s1 |
| InChIKey | LYZLHVCGWJEKHU-JAHCWSGRSA-N |
| XLogP | 2.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |