C20H23ClN2O2 — CID 171711954
[(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-hydroxyphenyl)methanone;hydrochloride (PubChem CID 171711954) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is [(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-hydroxyphenyl)methanone;hydrochloride.
| Compound Name | [(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-hydroxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171711954 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(3R,3aS,6aS)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-hydroxyphenyl)methanone;hydrochloride |
| SMILES | CN1C[C@H]2CN(C(=O)c3ccc(O)cc3)C[C@H]2[C@@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C20H22N2O2.ClH/c1-21-11-16-12-22(20(24)15-7-9-17(23)10-8-15)13-18(16)19(21)14-5-3-2-4-6-14;/h2-10,16,18-19,23H,11-13H2,1H3;1H/t16-,18+,19-;/m0./s1 |
| InChIKey | MXIXFZCHPGMJFG-DDBXZWFTSA-N |
| XLogP | 3.19 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |