C24H28N2O5 — CID 171707394
formic acid;methyl 4-[[(3aS,4R,6aR)-5-acetyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzoate (PubChem CID 171707394) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is formic acid;methyl 4-[[(3aS,4R,6aR)-5-acetyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzoate.
| Compound Name | formic acid;methyl 4-[[(3aS,4R,6aR)-5-acetyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 171707394 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | formic acid;methyl 4-[[(3aS,4R,6aR)-5-acetyl-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C[C@@H]3CN(C(C)=O)[C@@H](c4ccccc4)[C@@H]3C2)cc1.O=CO |
| InChI | InChI=1S/C23H26N2O3.CH2O2/c1-16(26)25-14-20-13-24(12-17-8-10-19(11-9-17)23(27)28-2)15-21(20)22(25)18-6-4-3-5-7-18;2-1-3/h3-11,20-22H,12-15H2,1-2H3;1H,(H,2,3)/t20-,21-,22+;/m1./s1 |
| InChIKey | WQNYLVQYNTXSRQ-NAMGLFDPSA-N |
| XLogP | 2.83 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|