C22H27IN2O2 — CID 135269460
methyl 4-[[(3S)-4-[(2-iodophenyl)methyl]-3,5-dimethylpiperazin-1-yl]methyl]benzoate (PubChem CID 135269460) has the molecular formula C22H27IN2O2 and a molecular weight of 478.37 g/mol. Its IUPAC name is methyl 4-[[(3S)-4-[(2-iodophenyl)methyl]-3,5-dimethylpiperazin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(3S)-4-[(2-iodophenyl)methyl]-3,5-dimethylpiperazin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 135269460 |
| Molecular Formula | C22H27IN2O2 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | methyl 4-[[(3S)-4-[(2-iodophenyl)methyl]-3,5-dimethylpiperazin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CC(C)N(Cc3ccccc3I)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C22H27IN2O2/c1-16-12-24(14-18-8-10-19(11-9-18)22(26)27-3)13-17(2)25(16)15-20-6-4-5-7-21(20)23/h4-11,16-17H,12-15H2,1-3H3/t16-,17?/m0/s1 |
| InChIKey | YVNCHYGTZQWDSS-BHWOMJMDSA-N |
| XLogP | 4.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|