C24H33N3O2 — CID 118367462
methyl 4-[[(2S,6R)-4-[[4-(dimethylamino)phenyl]methyl]-2,6-dimethylpiperazin-1-yl]methyl]benzoate (PubChem CID 118367462) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is methyl 4-[[(2S,6R)-4-[[4-(dimethylamino)phenyl]methyl]-2,6-dimethylpiperazin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(2S,6R)-4-[[4-(dimethylamino)phenyl]methyl]-2,6-dimethylpiperazin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 118367462 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | methyl 4-[[(2S,6R)-4-[[4-(dimethylamino)phenyl]methyl]-2,6-dimethylpiperazin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2[C@H](C)CN(Cc3ccc(N(C)C)cc3)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-18-14-26(16-20-8-12-23(13-9-20)25(3)4)15-19(2)27(18)17-21-6-10-22(11-7-21)24(28)29-5/h6-13,18-19H,14-17H2,1-5H3/t18-,19+ |
| InChIKey | VTKMDRUJADXVBE-KDURUIRLSA-N |
| XLogP | 3.63 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|