C25H28N4O4 — CID 172897446
[(3aR,4S,6aS)-4-phenyl-2-(1H-pyrazol-4-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-methoxyphenyl)methanone;formic acid (PubChem CID 172897446) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-phenyl-2-(1H-pyrazol-4-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-methoxyphenyl)methanone;formic acid.
| Compound Name | [(3aR,4S,6aS)-4-phenyl-2-(1H-pyrazol-4-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-methoxyphenyl)methanone;formic acid |
|---|---|
| PubChem CID | 172897446 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(3aR,4S,6aS)-4-phenyl-2-(1H-pyrazol-4-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-methoxyphenyl)methanone;formic acid |
| SMILES | COc1cccc(C(=O)N2C[C@@H]3CN(Cc4cn[nH]c4)C[C@@H]3[C@H]2c2ccccc2)c1.O=CO |
| InChI | InChI=1S/C24H26N4O2.CH2O2/c1-30-21-9-5-8-19(10-21)24(29)28-15-20-14-27(13-17-11-25-26-12-17)16-22(20)23(28)18-6-3-2-4-7-18;2-1-3/h2-12,20,22-23H,13-16H2,1H3,(H,25,26);1H,(H,2,3)/t20-,22-,23+;/m0./s1 |
| InChIKey | CAVXUQXHFDTLEN-HRMSIUJGSA-N |
| XLogP | 3.06 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|