C24H24N4O2 — CID 170506637
[(3aR,4S,6aS)-4-phenyl-2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-methoxyphenyl)methanone (PubChem CID 170506637) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-phenyl-2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(3aR,4S,6aS)-4-phenyl-2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 170506637 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [(3aR,4S,6aS)-4-phenyl-2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2C[C@@H]3CN(c4cnccn4)C[C@@H]3[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C24H24N4O2/c1-30-20-9-5-8-18(12-20)24(29)28-15-19-14-27(22-13-25-10-11-26-22)16-21(19)23(28)17-6-3-2-4-7-17/h2-13,19,21,23H,14-16H2,1H3/t19-,21-,23+/m0/s1 |
| InChIKey | QCXHFCPLJULERO-IEIRFRATSA-N |
| XLogP | 3.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |