C17H21NO2 — CID 122152021
(2,3-dicyclopropylazetidin-1-yl)-(3-methoxyphenyl)methanone (PubChem CID 122152021) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (2,3-dicyclopropylazetidin-1-yl)-(3-methoxyphenyl)methanone.
| Compound Name | (2,3-dicyclopropylazetidin-1-yl)-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 122152021 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (2,3-dicyclopropylazetidin-1-yl)-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CC(C3CC3)C2C2CC2)c1 |
| InChI | InChI=1S/C17H21NO2/c1-20-14-4-2-3-13(9-14)17(19)18-10-15(11-5-6-11)16(18)12-7-8-12/h2-4,9,11-12,15-16H,5-8,10H2,1H3 |
| InChIKey | WYZQOMWXJRHWFK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |