C20H24N4O3S — CID 171915856
[(3aR,4S,6aR)-4-phenyl-2-propylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyrazin-2-ylmethanone (PubChem CID 171915856) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is [(3aR,4S,6aR)-4-phenyl-2-propylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3aR,4S,6aR)-4-phenyl-2-propylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 171915856 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [(3aR,4S,6aR)-4-phenyl-2-propylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyrazin-2-ylmethanone |
| SMILES | CCCS(=O)(=O)N1C[C@H]2CN(C(=O)c3cnccn3)[C@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C20H24N4O3S/c1-2-10-28(26,27)23-12-16-13-24(20(25)18-11-21-8-9-22-18)19(17(16)14-23)15-6-4-3-5-7-15/h3-9,11,16-17,19H,2,10,12-14H2,1H3/t16-,17-,19+/m0/s1 |
| InChIKey | VRYOSDDHCFMDEG-JENIJYKNSA-N |
| XLogP | 1.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |