C26H29N3O — CID 171912595
2-[[(3aR,4R,6aS)-5-(cyclopentanecarbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzonitrile (PubChem CID 171912595) has the molecular formula C26H29N3O and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-[[(3aR,4R,6aS)-5-(cyclopentanecarbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzonitrile.
| Compound Name | 2-[[(3aR,4R,6aS)-5-(cyclopentanecarbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 171912595 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 2-[[(3aR,4R,6aS)-5-(cyclopentanecarbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C[C@H]2CN(C(=O)C3CCCC3)[C@@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C26H29N3O/c27-14-21-12-6-7-13-22(21)15-28-16-23-17-29(26(30)20-10-4-5-11-20)25(24(23)18-28)19-8-2-1-3-9-19/h1-3,6-9,12-13,20,23-25H,4-5,10-11,15-18H2/t23-,24-,25-/m0/s1 |
| InChIKey | RTORRIOQTNQPKU-SDHOMARFSA-N |
| XLogP | 4.38 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |