C21H25Cl2N3 — CID 171325140
2-[[(3R,3aS,6aR)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]benzonitrile;dihydrochloride (PubChem CID 171325140) has the molecular formula C21H25Cl2N3 and a molecular weight of 390.36 g/mol. Its IUPAC name is 2-[[(3R,3aS,6aR)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]benzonitrile;dihydrochloride.
| Compound Name | 2-[[(3R,3aS,6aR)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171325140 |
| Molecular Formula | C21H25Cl2N3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[[(3R,3aS,6aR)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]benzonitrile;dihydrochloride |
| SMILES | CN1C[C@H]2CN(Cc3ccccc3C#N)C[C@H]2[C@@H]1c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C21H23N3.2ClH/c1-23-12-19-14-24(13-18-10-6-5-9-17(18)11-22)15-20(19)21(23)16-7-3-2-4-8-16;;/h2-10,19-21H,12-15H2,1H3;2*1H/t19-,20+,21-;;/m0../s1 |
| InChIKey | VJQKECDYJLOYJG-YDMVQGAPSA-N |
| XLogP | 4.14 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |