C20H25Cl3N2 — CID 171329841
(3R,3aS,6aR)-5-[(3-chlorophenyl)methyl]-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 171329841) has the molecular formula C20H25Cl3N2 and a molecular weight of 399.79 g/mol. Its IUPAC name is (3R,3aS,6aR)-5-[(3-chlorophenyl)methyl]-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3R,3aS,6aR)-5-[(3-chlorophenyl)methyl]-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 171329841 |
| Molecular Formula | C20H25Cl3N2 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (3R,3aS,6aR)-5-[(3-chlorophenyl)methyl]-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | CN1C[C@H]2CN(Cc3cccc(Cl)c3)C[C@H]2[C@@H]1c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C20H23ClN2.2ClH/c1-22-12-17-13-23(11-15-6-5-9-18(21)10-15)14-19(17)20(22)16-7-3-2-4-8-16;;/h2-10,17,19-20H,11-14H2,1H3;2*1H/t17-,19+,20-;;/m0../s1 |
| InChIKey | BQGZOBDRGWRRHO-HVOYFDFJSA-N |
| XLogP | 4.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |