C22H30Cl2N2O2 — CID 171330719
2-[3-[[(3R,3aS,6aR)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]phenoxy]ethanol;dihydrochloride (PubChem CID 171330719) has the molecular formula C22H30Cl2N2O2 and a molecular weight of 425.40 g/mol. Its IUPAC name is 2-[3-[[(3R,3aS,6aR)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]phenoxy]ethanol;dihydrochloride.
| Compound Name | 2-[3-[[(3R,3aS,6aR)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]phenoxy]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 171330719 |
| Molecular Formula | C22H30Cl2N2O2 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[3-[[(3R,3aS,6aR)-2-methyl-3-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]phenoxy]ethanol;dihydrochloride |
| SMILES | CN1C[C@H]2CN(Cc3cccc(OCCO)c3)C[C@H]2[C@@H]1c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C22H28N2O2.2ClH/c1-23-14-19-15-24(13-17-6-5-9-20(12-17)26-11-10-25)16-21(19)22(23)18-7-3-2-4-8-18;;/h2-9,12,19,21-22,25H,10-11,13-16H2,1H3;2*1H/t19-,21+,22-;;/m0../s1 |
| InChIKey | RZGOWFPQYVBPAT-FRJQNZBKSA-N |
| XLogP | 3.64 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |