C22H28N2O3 — CID 134705465
2-[3-[[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]phenoxy]ethanol (PubChem CID 134705465) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[3-[[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[3-[[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 134705465 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-[3-[[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]phenoxy]ethanol |
| SMILES | OCCOc1cccc(CN2CCN3[C@@H](COC[C@@H]3c3ccccc3)C2)c1 |
| InChI | InChI=1S/C22H28N2O3/c25-11-12-27-21-8-4-5-18(13-21)14-23-9-10-24-20(15-23)16-26-17-22(24)19-6-2-1-3-7-19/h1-8,13,20,22,25H,9-12,14-17H2/t20-,22-/m1/s1 |
| InChIKey | FSSNLBPHWFXQKC-IFMALSPDSA-N |
| XLogP | 2.32 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |