C19H32N2O3 — CID 51635094
2-[(2S)-4-[[3-(2-hydroxyethoxy)phenyl]methyl]-1-(2-methylpropyl)piperazin-2-yl]ethanol (PubChem CID 51635094) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-[(2S)-4-[[3-(2-hydroxyethoxy)phenyl]methyl]-1-(2-methylpropyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-[[3-(2-hydroxyethoxy)phenyl]methyl]-1-(2-methylpropyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 51635094 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 2-[(2S)-4-[[3-(2-hydroxyethoxy)phenyl]methyl]-1-(2-methylpropyl)piperazin-2-yl]ethanol |
| SMILES | CC(C)CN1CCN(Cc2cccc(OCCO)c2)C[C@@H]1CCO |
| InChI | InChI=1S/C19H32N2O3/c1-16(2)13-21-8-7-20(15-18(21)6-9-22)14-17-4-3-5-19(12-17)24-11-10-23/h3-5,12,16,18,22-23H,6-11,13-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | CPHGNEUDHVTXCR-SFHVURJKSA-N |
| XLogP | 1.58 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |