C20H34N2O — CID 45238796
2-[1-(2-methylpropyl)-4-[(4-propan-2-ylphenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 45238796) has the molecular formula C20H34N2O and a molecular weight of 318.51 g/mol. Its IUPAC name is 2-[1-(2-methylpropyl)-4-[(4-propan-2-ylphenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[1-(2-methylpropyl)-4-[(4-propan-2-ylphenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45238796 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 2-[1-(2-methylpropyl)-4-[(4-propan-2-ylphenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | CC(C)CN1CCN(Cc2ccc(C(C)C)cc2)CC1CCO |
| InChI | InChI=1S/C20H34N2O/c1-16(2)13-22-11-10-21(15-20(22)9-12-23)14-18-5-7-19(8-6-18)17(3)4/h5-8,16-17,20,23H,9-15H2,1-4H3 |
| InChIKey | JGRXDXZLZVXNTI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |