C20H26N2OS — CID 134713607
(4S,9aR)-8-[(5-ethylthiophen-2-yl)methyl]-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 134713607) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is (4S,9aR)-8-[(5-ethylthiophen-2-yl)methyl]-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-8-[(5-ethylthiophen-2-yl)methyl]-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 134713607 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (4S,9aR)-8-[(5-ethylthiophen-2-yl)methyl]-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | CCc1ccc(CN2CCN3[C@@H](COC[C@@H]3c3ccccc3)C2)s1 |
| InChI | InChI=1S/C20H26N2OS/c1-2-18-8-9-19(24-18)13-21-10-11-22-17(12-21)14-23-15-20(22)16-6-4-3-5-7-16/h3-9,17,20H,2,10-15H2,1H3/t17-,20-/m1/s1 |
| InChIKey | HEJQIQMKMGZDBE-YLJYHZDGSA-N |
| XLogP | 3.57 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |