C21H26N2O — CID 155909122
(4S,9aR)-4-methyl-8-[(2-phenylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 155909122) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (4S,9aR)-4-methyl-8-[(2-phenylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-4-methyl-8-[(2-phenylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 155909122 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (4S,9aR)-4-methyl-8-[(2-phenylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | C[C@H]1COC[C@H]2CN(Cc3ccccc3-c3ccccc3)CCN21 |
| InChI | InChI=1S/C21H26N2O/c1-17-15-24-16-20-14-22(11-12-23(17)20)13-19-9-5-6-10-21(19)18-7-3-2-4-8-18/h2-10,17,20H,11-16H2,1H3/t17-,20+/m0/s1 |
| InChIKey | LRUCJPLIGOWUHM-FXAWDEMLSA-N |
| XLogP | 3.26 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |