C20H23NO — CID 138806797
(3aR,6aS)-2-[(2-phenylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol (PubChem CID 138806797) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (3aR,6aS)-2-[(2-phenylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aR,6aS)-2-[(2-phenylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 138806797 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (3aR,6aS)-2-[(2-phenylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
| SMILES | OC1C[C@@H]2CN(Cc3ccccc3-c3ccccc3)C[C@@H]2C1 |
| InChI | InChI=1S/C20H23NO/c22-19-10-17-13-21(14-18(17)11-19)12-16-8-4-5-9-20(16)15-6-2-1-3-7-15/h1-9,17-19,22H,10-14H2/t17-,18+,19? |
| InChIKey | RAPYOZNXLXQSIG-DFNIBXOVSA-N |
| XLogP | 3.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |