C18H25FN2O — CID 134710666
(4S,9aR)-4-cyclopropyl-8-[(3-fluoro-2-methylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 134710666) has the molecular formula C18H25FN2O and a molecular weight of 304.41 g/mol. Its IUPAC name is (4S,9aR)-4-cyclopropyl-8-[(3-fluoro-2-methylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-4-cyclopropyl-8-[(3-fluoro-2-methylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 134710666 |
| Molecular Formula | C18H25FN2O |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (4S,9aR)-4-cyclopropyl-8-[(3-fluoro-2-methylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | Cc1c(F)cccc1CN1CCN2[C@@H](COC[C@@H]2C2CC2)C1 |
| InChI | InChI=1S/C18H25FN2O/c1-13-15(3-2-4-17(13)19)9-20-7-8-21-16(10-20)11-22-12-18(21)14-5-6-14/h2-4,14,16,18H,5-12H2,1H3/t16-,18-/m1/s1 |
| InChIKey | QGXGETVOHJOSPN-SJLPKXTDSA-N |
| XLogP | 2.43 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |