C22H30N4O — CID 155918299
(4S,9aR)-4-cyclopropyl-8-[[1-(3,4-dimethylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 155918299) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is (4S,9aR)-4-cyclopropyl-8-[[1-(3,4-dimethylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-4-cyclopropyl-8-[[1-(3,4-dimethylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 155918299 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (4S,9aR)-4-cyclopropyl-8-[[1-(3,4-dimethylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | Cc1ccc(-n2cc(CN3CCN4[C@@H](COC[C@@H]4C4CC4)C3)cn2)cc1C |
| InChI | InChI=1S/C22H30N4O/c1-16-3-6-20(9-17(16)2)26-12-18(10-23-26)11-24-7-8-25-21(13-24)14-27-15-22(25)19-4-5-19/h3,6,9-10,12,19,21-22H,4-5,7-8,11,13-15H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | RJOBVEWGIFHZJA-FGZHOGPDSA-N |
| XLogP | 2.78 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |