C21H32N2O2 — CID 70731413
2-[3-[[(1S,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]methyl]phenoxy]ethanol (PubChem CID 70731413) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-[3-[[(1S,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[3-[[(1S,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 70731413 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 2-[3-[[(1S,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]methyl]phenoxy]ethanol |
| SMILES | CC(C)=CCN1C[C@H]2CC[C@@H]1CN(Cc1cccc(OCCO)c1)C2 |
| InChI | InChI=1S/C21H32N2O2/c1-17(2)8-9-23-15-19-6-7-20(23)16-22(14-19)13-18-4-3-5-21(12-18)25-11-10-24/h3-5,8,12,19-20,24H,6-7,9-11,13-16H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | BVMRPTWHRHOEMU-VQTJNVASSA-N |
| XLogP | 2.92 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|