C25H31N3O2 — CID 171907087
3-[[(3aR,4S,6aS)-5-(cyclopentanecarbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1H-pyridin-2-one (PubChem CID 171907087) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3-[[(3aR,4S,6aS)-5-(cyclopentanecarbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1H-pyridin-2-one.
| Compound Name | 3-[[(3aR,4S,6aS)-5-(cyclopentanecarbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171907087 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 3-[[(3aR,4S,6aS)-5-(cyclopentanecarbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1H-pyridin-2-one |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(Cc3ccc[nH]c3=O)C[C@H]2CN1C(=O)C1CCCC1 |
| InChI | InChI=1S/C25H31N3O2/c1-17-7-2-5-11-21(17)23-22-16-27(13-19-10-6-12-26-24(19)29)14-20(22)15-28(23)25(30)18-8-3-4-9-18/h2,5-7,10-12,18,20,22-23H,3-4,8-9,13-16H2,1H3,(H,26,29)/t20-,22-,23+/m0/s1 |
| InChIKey | FUJGMNZNDSMAPO-ACIOBRDBSA-N |
| XLogP | 3.51 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |