C25H28N4O — CID 171911149
[(3aR,4S,6aS)-2-[(1-methylimidazol-2-yl)methyl]-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone (PubChem CID 171911149) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is [(3aR,4S,6aS)-2-[(1-methylimidazol-2-yl)methyl]-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone.
| Compound Name | [(3aR,4S,6aS)-2-[(1-methylimidazol-2-yl)methyl]-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 171911149 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | [(3aR,4S,6aS)-2-[(1-methylimidazol-2-yl)methyl]-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(Cc3nccn3C)C[C@H]2CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O/c1-18-8-6-7-11-21(18)24-22-16-28(17-23-26-12-13-27(23)2)14-20(22)15-29(24)25(30)19-9-4-3-5-10-19/h3-13,20,22,24H,14-17H2,1-2H3/t20-,22-,24+/m0/s1 |
| InChIKey | HFTOEZWDZLAOHD-ODGPQVTHSA-N |
| XLogP | 3.67 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |