C27H39N5O5 — CID 171329755
(3aS,4R,6aR)-2-[(1-cyclopropylimidazol-2-yl)methyl]-N,N-dimethyl-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;acetic acid (PubChem CID 171329755) has the molecular formula C27H39N5O5 and a molecular weight of 513.64 g/mol. Its IUPAC name is (3aS,4R,6aR)-2-[(1-cyclopropylimidazol-2-yl)methyl]-N,N-dimethyl-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;acetic acid.
| Compound Name | (3aS,4R,6aR)-2-[(1-cyclopropylimidazol-2-yl)methyl]-N,N-dimethyl-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;acetic acid |
|---|---|
| PubChem CID | 171329755 |
| Molecular Formula | C27H39N5O5 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | (3aS,4R,6aR)-2-[(1-cyclopropylimidazol-2-yl)methyl]-N,N-dimethyl-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;acetic acid |
| SMILES | CC(=O)O.CC(=O)O.Cc1ccccc1[C@H]1[C@@H]2CN(Cc3nccn3C3CC3)C[C@@H]2CN1C(=O)N(C)C |
| InChI | InChI=1S/C23H31N5O.2C2H4O2/c1-16-6-4-5-7-19(16)22-20-14-26(12-17(20)13-28(22)23(29)25(2)3)15-21-24-10-11-27(21)18-8-9-18;2*1-2(3)4/h4-7,10-11,17-18,20,22H,8-9,12-15H2,1-3H3;2*1H3,(H,3,4)/t17-,20-,22+;;/m1../s1 |
| InChIKey | MGFZPDPBNPKHTO-YKVPZSLSSA-N |
| XLogP | 3.49 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |