C25H33N3O2 — CID 171385324
1-[(3aR,4R,6aS)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopentylethanone (PubChem CID 171385324) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopentylethanone.
| Compound Name | 1-[(3aR,4R,6aS)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopentylethanone |
|---|---|
| PubChem CID | 171385324 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-[(3aR,4R,6aS)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopentylethanone |
| SMILES | Cc1cc(CN2C[C@H]3CN(C(=O)CC4CCCC4)[C@@H](c4ccccc4C)[C@H]3C2)no1 |
| InChI | InChI=1S/C25H33N3O2/c1-17-7-3-6-10-22(17)25-23-16-27(15-21-11-18(2)30-26-21)13-20(23)14-28(25)24(29)12-19-8-4-5-9-19/h3,6-7,10-11,19-20,23,25H,4-5,8-9,12-16H2,1-2H3/t20-,23-,25-/m0/s1 |
| InChIKey | JAJZQPKVUZVUEO-OPHFCASCSA-N |
| XLogP | 4.50 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |