C14H16N2 — CID 67927146
1-cyclopropyl-2-[(2-methylphenyl)methyl]imidazole (PubChem CID 67927146) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(2-methylphenyl)methyl]imidazole.
| Compound Name | 1-cyclopropyl-2-[(2-methylphenyl)methyl]imidazole |
|---|---|
| PubChem CID | 67927146 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-cyclopropyl-2-[(2-methylphenyl)methyl]imidazole |
| SMILES | Cc1ccccc1Cc1nccn1C1CC1 |
| InChI | InChI=1S/C14H16N2/c1-11-4-2-3-5-12(11)10-14-15-8-9-16(14)13-6-7-13/h2-5,8-9,13H,6-7,10H2,1H3 |
| InChIKey | TWQGNXOAVZUXPP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |