C15H19N3 — CID 82558770
2-[(1-cyclopentylimidazol-2-yl)methyl]aniline (PubChem CID 82558770) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-[(1-cyclopentylimidazol-2-yl)methyl]aniline.
| Compound Name | 2-[(1-cyclopentylimidazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 82558770 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-[(1-cyclopentylimidazol-2-yl)methyl]aniline |
| SMILES | Nc1ccccc1Cc1nccn1C1CCCC1 |
| InChI | InChI=1S/C15H19N3/c16-14-8-4-1-5-12(14)11-15-17-9-10-18(15)13-6-2-3-7-13/h1,4-5,8-10,13H,2-3,6-7,11,16H2 |
| InChIKey | PBCJFZQZLJRWRF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|