C24H33Cl2N3O — CID 171330303
4-[[(3S,3aS,6aR)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-N,N-dimethylbenzamide;dihydrochloride (PubChem CID 171330303) has the molecular formula C24H33Cl2N3O and a molecular weight of 450.45 g/mol. Its IUPAC name is 4-[[(3S,3aS,6aR)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-N,N-dimethylbenzamide;dihydrochloride.
| Compound Name | 4-[[(3S,3aS,6aR)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-N,N-dimethylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 171330303 |
| Molecular Formula | C24H33Cl2N3O |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-[[(3S,3aS,6aR)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methyl]-N,N-dimethylbenzamide;dihydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@@H]2CN(Cc3ccc(C(=O)N(C)C)cc3)C[C@@H]2CN1C.Cl.Cl |
| InChI | InChI=1S/C24H31N3O.2ClH/c1-17-7-5-6-8-21(17)23-22-16-27(15-20(22)14-26(23)4)13-18-9-11-19(12-10-18)24(28)25(2)3;;/h5-12,20,22-23H,13-16H2,1-4H3;2*1H/t20-,22+,23+;;/m0../s1 |
| InChIKey | QIHUUMGTFWNZRO-AUBZFFHBSA-N |
| XLogP | 4.28 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |