C22H29Cl2FN2O — CID 171330571
(3R,3aS,6aR)-5-[(2-fluoro-5-methoxyphenyl)methyl]-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 171330571) has the molecular formula C22H29Cl2FN2O and a molecular weight of 427.39 g/mol. Its IUPAC name is (3R,3aS,6aR)-5-[(2-fluoro-5-methoxyphenyl)methyl]-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3R,3aS,6aR)-5-[(2-fluoro-5-methoxyphenyl)methyl]-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 171330571 |
| Molecular Formula | C22H29Cl2FN2O |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (3R,3aS,6aR)-5-[(2-fluoro-5-methoxyphenyl)methyl]-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | COc1ccc(F)c(CN2C[C@@H]3CN(C)[C@@H](c4ccccc4C)[C@@H]3C2)c1.Cl.Cl |
| InChI | InChI=1S/C22H27FN2O.2ClH/c1-15-6-4-5-7-19(15)22-20-14-25(13-17(20)11-24(22)2)12-16-10-18(26-3)8-9-21(16)23;;/h4-10,17,20,22H,11-14H2,1-3H3;2*1H/t17-,20+,22-;;/m0../s1 |
| InChIKey | HVMWYPUYXUNPEG-PJNQRLPKSA-N |
| XLogP | 4.72 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |