C25H31Cl2N3O — CID 171330223
2-[(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-7-methoxy-4-methylquinoline;dihydrochloride (PubChem CID 171330223) has the molecular formula C25H31Cl2N3O and a molecular weight of 460.45 g/mol. Its IUPAC name is 2-[(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-7-methoxy-4-methylquinoline;dihydrochloride.
| Compound Name | 2-[(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-7-methoxy-4-methylquinoline;dihydrochloride |
|---|---|
| PubChem CID | 171330223 |
| Molecular Formula | C25H31Cl2N3O |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-7-methoxy-4-methylquinoline;dihydrochloride |
| SMILES | COc1ccc2c(C)cc(N3C[C@@H]4CN(C)[C@@H](c5ccccc5C)[C@@H]4C3)nc2c1.Cl.Cl |
| InChI | InChI=1S/C25H29N3O.2ClH/c1-16-7-5-6-8-21(16)25-22-15-28(14-18(22)13-27(25)3)24-11-17(2)20-10-9-19(29-4)12-23(20)26-24;;/h5-12,18,22,25H,13-15H2,1-4H3;2*1H/t18-,22+,25-;;/m0../s1 |
| InChIKey | HIOYLROTXHPWFS-SHQODSPKSA-N |
| XLogP | 5.44 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |