C20H25Cl2F3N2O — CID 171330315
(3R,3aS,6aR)-2-methyl-3-(2-methylphenyl)-5-[[5-(trifluoromethyl)furan-2-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 171330315) has the molecular formula C20H25Cl2F3N2O and a molecular weight of 437.33 g/mol. Its IUPAC name is (3R,3aS,6aR)-2-methyl-3-(2-methylphenyl)-5-[[5-(trifluoromethyl)furan-2-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3R,3aS,6aR)-2-methyl-3-(2-methylphenyl)-5-[[5-(trifluoromethyl)furan-2-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 171330315 |
| Molecular Formula | C20H25Cl2F3N2O |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (3R,3aS,6aR)-2-methyl-3-(2-methylphenyl)-5-[[5-(trifluoromethyl)furan-2-yl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(Cc3ccc(C(F)(F)F)o3)C[C@@H]2CN1C.Cl.Cl |
| InChI | InChI=1S/C20H23F3N2O.2ClH/c1-13-5-3-4-6-16(13)19-17-12-25(10-14(17)9-24(19)2)11-15-7-8-18(26-15)20(21,22)23;;/h3-8,14,17,19H,9-12H2,1-2H3;2*1H/t14-,17+,19-;;/m0../s1 |
| InChIKey | PIHUDJBLWAVQOI-KFWHTRIGSA-N |
| XLogP | 5.19 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |