C22H29ClN2O2S — CID 171709408
(3R,3aS,6aS)-5-(2,5-dimethylphenyl)sulfonyl-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 171709408) has the molecular formula C22H29ClN2O2S and a molecular weight of 421.01 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-(2,5-dimethylphenyl)sulfonyl-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3R,3aS,6aS)-5-(2,5-dimethylphenyl)sulfonyl-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 171709408 |
| Molecular Formula | C22H29ClN2O2S |
| Molecular Weight | 421.01 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (3R,3aS,6aS)-5-(2,5-dimethylphenyl)sulfonyl-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2C[C@@H]3CN(C)[C@@H](c4ccccc4C)[C@@H]3C2)c1.Cl |
| InChI | InChI=1S/C22H28N2O2S.ClH/c1-15-9-10-17(3)21(11-15)27(25,26)24-13-18-12-23(4)22(20(18)14-24)19-8-6-5-7-16(19)2;/h5-11,18,20,22H,12-14H2,1-4H3;1H/t18-,20+,22-;/m0./s1 |
| InChIKey | WJSTWKLZKPSSCT-NJXWTMNOSA-N |
| XLogP | 3.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.01 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |