C27H26F4N2O5 — CID 155868101
N-[(3aR,4S,8bR)-2-[(2-fluoro-5-methoxyphenyl)methyl]-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-5-methylfuran-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155868101) has the molecular formula C27H26F4N2O5 and a molecular weight of 534.51 g/mol. Its IUPAC name is N-[(3aR,4S,8bR)-2-[(2-fluoro-5-methoxyphenyl)methyl]-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-5-methylfuran-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3aR,4S,8bR)-2-[(2-fluoro-5-methoxyphenyl)methyl]-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-5-methylfuran-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155868101 |
| Molecular Formula | C27H26F4N2O5 |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | N-[(3aR,4S,8bR)-2-[(2-fluoro-5-methoxyphenyl)methyl]-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-5-methylfuran-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(F)c(CN2C[C@@H]3[C@H](NC(=O)c4ccc(C)o4)c4ccccc4[C@@H]3C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H25FN2O3.C2HF3O2/c1-15-7-10-23(31-15)25(29)27-24-19-6-4-3-5-18(19)20-13-28(14-21(20)24)12-16-11-17(30-2)8-9-22(16)26;3-2(4,5)1(6)7/h3-11,20-21,24H,12-14H2,1-2H3,(H,27,29);(H,6,7)/t20-,21-,24+;/m0./s1 |
| InChIKey | MQJRBIFSDBAYIE-JZHGLUDASA-N |
| XLogP | 5.07 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |