C24H26F4N2O5 — CID 155868363
N-[(3aR,4S,8bR)-2-[2-(3-fluorophenoxy)ethyl]-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155868363) has the molecular formula C24H26F4N2O5 and a molecular weight of 498.47 g/mol. Its IUPAC name is N-[(3aR,4S,8bR)-2-[2-(3-fluorophenoxy)ethyl]-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3aR,4S,8bR)-2-[2-(3-fluorophenoxy)ethyl]-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155868363 |
| Molecular Formula | C24H26F4N2O5 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-[(3aR,4S,8bR)-2-[2-(3-fluorophenoxy)ethyl]-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)N[C@@H]1c2ccccc2[C@@H]2CN(CCOc3cccc(F)c3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H25FN2O3.C2HF3O2/c1-27-14-21(26)24-22-18-8-3-2-7-17(18)19-12-25(13-20(19)22)9-10-28-16-6-4-5-15(23)11-16;3-2(4,5)1(6)7/h2-8,11,19-20,22H,9-10,12-14H2,1H3,(H,24,26);(H,6,7)/t19-,20-,22+;/m0./s1 |
| InChIKey | WJFMXYHOGNOISK-MBQLYDGSSA-N |
| XLogP | 3.37 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |