C22H22N4OS — CID 170502609
[(3aR,4S,6aR)-4-(2-methylphenyl)-2-(1,3,4-thiadiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone (PubChem CID 170502609) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is [(3aR,4S,6aR)-4-(2-methylphenyl)-2-(1,3,4-thiadiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone.
| Compound Name | [(3aR,4S,6aR)-4-(2-methylphenyl)-2-(1,3,4-thiadiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 170502609 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [(3aR,4S,6aR)-4-(2-methylphenyl)-2-(1,3,4-thiadiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(c3nncs3)C[C@H]2CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N4OS/c1-15-7-5-6-10-18(15)20-19-13-25(22-24-23-14-28-22)11-17(19)12-26(20)21(27)16-8-3-2-4-9-16/h2-10,14,17,19-20H,11-13H2,1H3/t17-,19-,20+/m0/s1 |
| InChIKey | LHGYFUVZAXEILR-YSIASYRMSA-N |
| XLogP | 3.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |