C24H29N3O2 — CID 171908837
[(3aR,4S,6aS)-4-(2-methylphenyl)-2-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridin-3-ylmethanone (PubChem CID 171908837) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(2-methylphenyl)-2-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 171908837 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridin-3-ylmethanone |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(C3CCOCC3)C[C@H]2CN1C(=O)c1cccnc1 |
| InChI | InChI=1S/C24H29N3O2/c1-17-5-2-3-7-21(17)23-22-16-26(20-8-11-29-12-9-20)14-19(22)15-27(23)24(28)18-6-4-10-25-13-18/h2-7,10,13,19-20,22-23H,8-9,11-12,14-16H2,1H3/t19-,22-,23+/m0/s1 |
| InChIKey | KKVBZDUNMLEPHZ-AJSBUHFISA-N |
| XLogP | 3.31 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |