C23H24N4O3 — CID 171385971
[(3aR,4R,6aS)-5-(2-methyl-1H-imidazole-5-carbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(furan-3-yl)methanone (PubChem CID 171385971) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is [(3aR,4R,6aS)-5-(2-methyl-1H-imidazole-5-carbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(furan-3-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-5-(2-methyl-1H-imidazole-5-carbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 171385971 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(3aR,4R,6aS)-5-(2-methyl-1H-imidazole-5-carbonyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(furan-3-yl)methanone |
| SMILES | Cc1ncc(C(=O)N2C[C@@H]3CN(C(=O)c4ccoc4)C[C@@H]3[C@@H]2c2ccccc2C)[nH]1 |
| InChI | InChI=1S/C23H24N4O3/c1-14-5-3-4-6-18(14)21-19-12-26(22(28)16-7-8-30-13-16)10-17(19)11-27(21)23(29)20-9-24-15(2)25-20/h3-9,13,17,19,21H,10-12H2,1-2H3,(H,24,25)/t17-,19-,21-/m0/s1 |
| InChIKey | FWAHTCDLLAOWTF-CUWPLCDZSA-N |
| XLogP | 3.21 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |