C23H24N2O3 — CID 170506012
[(3aR,4S,6aS)-5-(furan-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-cyclopent-3-en-1-ylmethanone (PubChem CID 170506012) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is [(3aR,4S,6aS)-5-(furan-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-cyclopent-3-en-1-ylmethanone.
| Compound Name | [(3aR,4S,6aS)-5-(furan-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-cyclopent-3-en-1-ylmethanone |
|---|---|
| PubChem CID | 170506012 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [(3aR,4S,6aS)-5-(furan-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-cyclopent-3-en-1-ylmethanone |
| SMILES | O=C(C1CC=CC1)N1C[C@H]2CN(C(=O)c3ccoc3)[C@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C23H24N2O3/c26-22(17-8-4-5-9-17)24-12-19-13-25(23(27)18-10-11-28-15-18)21(20(19)14-24)16-6-2-1-3-7-16/h1-7,10-11,15,17,19-21H,8-9,12-14H2/t19-,20-,21+/m0/s1 |
| InChIKey | QDLZQSZHDIIXPW-PCCBWWKXSA-N |
| XLogP | 3.52 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|