C26H40N2O4 — CID 59438636
tert-butyl (4R,7aS)-2-(3-acetyloxy-2,2-dimethylpropyl)-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 59438636) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is tert-butyl (4R,7aS)-2-(3-acetyloxy-2,2-dimethylpropyl)-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (4R,7aS)-2-(3-acetyloxy-2,2-dimethylpropyl)-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 59438636 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | tert-butyl (4R,7aS)-2-(3-acetyloxy-2,2-dimethylpropyl)-4-(2-methylphenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | CC(=O)OCC(C)(C)CN1CC2[C@H](CCN(C(=O)OC(C)(C)C)[C@H]2c2ccccc2C)C1 |
| InChI | InChI=1S/C26H40N2O4/c1-18-10-8-9-11-21(18)23-22-15-27(16-26(6,7)17-31-19(2)29)14-20(22)12-13-28(23)24(30)32-25(3,4)5/h8-11,20,22-23H,12-17H2,1-7H3/t20-,22?,23+/m1/s1 |
| InChIKey | ABZMSFMILHZXSI-FQXDTITESA-N |
| XLogP | 4.81 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |