C17H21N5O2S — CID 155963721
[(3aR,6aS)-5-(2-amino-1,3-thiazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(1,5-dimethylpyrrol-2-yl)methanone (PubChem CID 155963721) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is [(3aR,6aS)-5-(2-amino-1,3-thiazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(1,5-dimethylpyrrol-2-yl)methanone.
| Compound Name | [(3aR,6aS)-5-(2-amino-1,3-thiazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(1,5-dimethylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 155963721 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [(3aR,6aS)-5-(2-amino-1,3-thiazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(1,5-dimethylpyrrol-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3CN(C(=O)c4csc(N)n4)C[C@H]3C2)n1C |
| InChI | InChI=1S/C17H21N5O2S/c1-10-3-4-14(20(10)2)16(24)22-7-11-5-21(6-12(11)8-22)15(23)13-9-25-17(18)19-13/h3-4,9,11-12H,5-8H2,1-2H3,(H2,18,19)/t11-,12+ |
| InChIKey | YYYMFDXAKCCYOH-TXEJJXNPSA-N |
| XLogP | 1.22 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |