About [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone
[4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone (PubChem CID 62787370) has the molecular formula C12H16N4O2S
and a molecular weight of 280.35 g/mol. Its IUPAC name is [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone.
Molecular Properties
| Compound Name | [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone |
| PubChem CID | 62787370 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone |
| SMILES | Nc1nc(C(=O)N2CCN(C(=O)C3CC3)CC2)cs1 |
| InChI | InChI=1S/C12H16N4O2S/c13-12-14-9(7-19-12)11(18)16-5-3-15(4-6-16)10(17)8-1-2-8/h7-8H,1-6H2,(H2,13,14) |
| InChIKey | WQDOHTMIPKAAQO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone?
The IUPAC name of [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone (CID 62787370) is [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone.
What is the SMILES notation for [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone?
The canonical SMILES for [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone is Nc1nc(C(=O)N2CCN(C(=O)C3CC3)CC2)cs1.
What is the InChIKey of [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone?
The InChIKey is WQDOHTMIPKAAQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S/c13-12-14-9(7-19-12)11(18)16-5-3-15(4-6-16)10(17)8-1-2-8/h7-8H,1-6H2,(H2,13,14).
What are the key properties of [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone?
[4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone has a molecular weight of 280.35 g/mol, XLogP of 0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-amino-1,3-thiazole-4-carbonyl)piperazin-1-yl]-cyclopropylmethanone is sourced from PubChem (CID 62787370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).